About N-(9,10-dioxoanthracen-2-yl)benzamide
N-(9,10-dioxoanthracen-2-yl)benzamide (PubChem CID 570342) has the molecular formula C21H13NO3
and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(9,10-dioxoanthracen-2-yl)benzamide |
| PubChem CID | 570342 |
| Molecular Formula | C21H13NO3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C21H13NO3/c23-19-15-8-4-5-9-16(15)20(24)18-12-14(10-11-17(18)19)22-21(25)13-6-2-1-3-7-13/h1-12H,(H,22,25) |
| InChIKey | SIGATAYQAZTAOH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(9,10-dioxoanthracen-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9,10-dioxoanthracen-2-yl)benzamide?
The IUPAC name of N-(9,10-dioxoanthracen-2-yl)benzamide (CID 570342) is N-(9,10-dioxoanthracen-2-yl)benzamide.
What is the SMILES notation for N-(9,10-dioxoanthracen-2-yl)benzamide?
The canonical SMILES for N-(9,10-dioxoanthracen-2-yl)benzamide is O=C(Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccccc1.
What is the InChIKey of N-(9,10-dioxoanthracen-2-yl)benzamide?
The InChIKey is SIGATAYQAZTAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13NO3/c23-19-15-8-4-5-9-16(15)20(24)18-12-14(10-11-17(18)19)22-21(25)13-6-2-1-3-7-13/h1-12H,(H,22,25).
What are the key properties of N-(9,10-dioxoanthracen-2-yl)benzamide?
N-(9,10-dioxoanthracen-2-yl)benzamide has a molecular weight of 327.34 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9,10-dioxoanthracen-2-yl)benzamide is sourced from PubChem (CID 570342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).