C15H15NO — CID 57034688
(1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine (PubChem CID 57034688) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine.
| Compound Name | (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
|---|---|
| PubChem CID | 57034688 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaen-9-amine |
| SMILES | NC1CC=c2cccc/c2=C2\C=CC=CC2O1 |
| InChI | InChI=1S/C15H15NO/c16-15-10-9-11-5-1-2-6-12(11)13-7-3-4-8-14(13)17-15/h1-9,14-15H,10,16H2/b11-9?,13-12- |
| InChIKey | DPNPZEZBGQKTOC-FBZODJRUSA-N |
| XLogP | 0.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |