C21H13F3N2O3 — CID 57034814
2-(pyridin-3-ylmethyl)-5-[4-(trifluoromethyl)phenoxy]isoindole-1,3-dione (PubChem CID 57034814) has the molecular formula C21H13F3N2O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethyl)-5-[4-(trifluoromethyl)phenoxy]isoindole-1,3-dione.
| Compound Name | 2-(pyridin-3-ylmethyl)-5-[4-(trifluoromethyl)phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57034814 |
| Molecular Formula | C21H13F3N2O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(pyridin-3-ylmethyl)-5-[4-(trifluoromethyl)phenoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C21H13F3N2O3/c22-21(23,24)14-3-5-15(6-4-14)29-16-7-8-17-18(10-16)20(28)26(19(17)27)12-13-2-1-9-25-11-13/h1-11H,12H2 |
| InChIKey | BXSIHEJHGKDSAJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|