About 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine
6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine (PubChem CID 57034986) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine |
| PubChem CID | 57034986 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1(C(C)C)C(C)C |
| InChI | InChI=1S/C12H19N/c1-9(2)12(10(3)4)8-6-5-7-11(12)13/h5-10,13H,1-4H3/b13-11+ |
| InChIKey | KILNBZGSDOEGDW-ACCUITESSA-N |
| XLogP | 3.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine?
The IUPAC name of 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine (CID 57034986) is 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine?
The canonical SMILES for 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine is [H]/N=C1\C=CC=CC1(C(C)C)C(C)C.
What is the InChIKey of 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine?
The InChIKey is KILNBZGSDOEGDW-ACCUITESSA-N. The full InChI is InChI=1S/C12H19N/c1-9(2)12(10(3)4)8-6-5-7-11(12)13/h5-10,13H,1-4H3/b13-11+.
What are the key properties of 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine?
6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine has a molecular weight of 177.29 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 57034986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).