C21H26Cl2N2S — CID 57035073
1-[4-(3,4-dichlorophenyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-N-hexylmethanimine (PubChem CID 57035073) has the molecular formula C21H26Cl2N2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-N-hexylmethanimine.
| Compound Name | 1-[4-(3,4-dichlorophenyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-N-hexylmethanimine |
|---|---|
| PubChem CID | 57035073 |
| Molecular Formula | C21H26Cl2N2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-N-hexylmethanimine |
| SMILES | CCCCCC/N=C/c1cc2c(s1)CN(C)CC2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H26Cl2N2S/c1-3-4-5-6-9-24-12-16-11-17-18(13-25(2)14-21(17)26-16)15-7-8-19(22)20(23)10-15/h7-8,10-12,18H,3-6,9,13-14H2,1-2H3/b24-12+ |
| InChIKey | AEDJBPIQYGHXHJ-WYMPLXKRSA-N |
| XLogP | 6.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|