C27H44O3SSi — CID 57035490
[(1R,3aR,4S,7aR)-1-[5-(benzenesulfonyl)pent-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57035490) has the molecular formula C27H44O3SSi and a molecular weight of 476.80 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[5-(benzenesulfonyl)pent-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[5-(benzenesulfonyl)pent-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57035490 |
| Molecular Formula | C27H44O3SSi |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[5-(benzenesulfonyl)pent-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C=CCS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C27H44O3SSi/c1-21(13-12-20-31(28,29)22-14-9-8-10-15-22)23-17-18-24-25(16-11-19-27(23,24)5)30-32(6,7)26(2,3)4/h8-10,12-15,21,23-25H,11,16-20H2,1-7H3/t21?,23-,24+,25+,27-/m1/s1 |
| InChIKey | NLVYSSQXACCBFU-QRFATOCHSA-N |
| XLogP | 7.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|