6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid

C13H11NO3 — CID 57035952

IUPAC6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid
SMILESO=C(O)C1=CCc2cc3c(cc2O1)N=CCC3
InChIInChI=1S/C13H11NO3/c15-13(16)11-4-3-9-6-8-2-1-5-14-10(8)7-12(9)17-11/h4-7H,1-3H2,(H,15,16)
InChIKeyJNMCQQAUWCMEGG-UHFFFAOYSA-N
MW229.23 g/mol
LogP2.24
Rot. Bonds1

About 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid

6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid (PubChem CID 57035952) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid.

Molecular Properties

Compound Name6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid
PubChem CID57035952
Molecular FormulaC13H11NO3
Molecular Weight229.23 g/mol
Exact Mass229.07
IUPAC Name6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid
SMILESO=C(O)C1=CCc2cc3c(cc2O1)N=CCC3
InChIInChI=1S/C13H11NO3/c15-13(16)11-4-3-9-6-8-2-1-5-14-10(8)7-12(9)17-11/h4-7H,1-3H2,(H,15,16)
InChIKeyJNMCQQAUWCMEGG-UHFFFAOYSA-N
XLogP2.24
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.23
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid?
The IUPAC name of 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid (CID 57035952) is 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid.
What is the SMILES notation for 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid?
The canonical SMILES for 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid is O=C(O)C1=CCc2cc3c(cc2O1)N=CCC3.
What is the InChIKey of 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid?
The InChIKey is JNMCQQAUWCMEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c15-13(16)11-4-3-9-6-8-2-1-5-14-10(8)7-12(9)17-11/h4-7H,1-3H2,(H,15,16).
What are the key properties of 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid?
6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid has a molecular weight of 229.23 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-4H-pyrano[3,2-g]quinoline-2-carboxylic acid is sourced from PubChem (CID 57035952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).