About 1-(azet-2-yl)-3,6-dihydro-2H-pyridine
1-(azet-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 57036027) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1-(azet-2-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(azet-2-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 57036027 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1-(azet-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(C2=NC=C2)CC1 |
| InChI | InChI=1S/C8H10N2/c1-2-6-10(7-3-1)8-4-5-9-8/h1-2,4-5H,3,6-7H2 |
| InChIKey | MTRFIDRDCAWEMM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(azet-2-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azet-2-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-(azet-2-yl)-3,6-dihydro-2H-pyridine (CID 57036027) is 1-(azet-2-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-(azet-2-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-(azet-2-yl)-3,6-dihydro-2H-pyridine is C1=CCN(C2=NC=C2)CC1.
What is the InChIKey of 1-(azet-2-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is MTRFIDRDCAWEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-6-10(7-3-1)8-4-5-9-8/h1-2,4-5H,3,6-7H2.
What are the key properties of 1-(azet-2-yl)-3,6-dihydro-2H-pyridine?
1-(azet-2-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 134.18 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azet-2-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 57036027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).