C29H36O3 — CID 57036123
4-[2-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanyl]benzoic acid (PubChem CID 57036123) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is 4-[2-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanyl]benzoic acid.
| Compound Name | 4-[2-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanyl]benzoic acid |
|---|---|
| PubChem CID | 57036123 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 4-[2-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanyl]benzoic acid |
| SMILES | COC1(c2ccc(C(=O)O)cc2)CCC2(c3cc4c(cc3C)C(C)(C)CCC4(C)C)CC21 |
| InChI | InChI=1S/C29H36O3/c1-18-15-22-23(27(4,5)12-11-26(22,2)3)16-21(18)28-13-14-29(32-6,24(28)17-28)20-9-7-19(8-10-20)25(30)31/h7-10,15-16,24H,11-14,17H2,1-6H3,(H,30,31) |
| InChIKey | WNKXMONSOHRYES-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |