About 1-chloro-1,2-dimethoxyethene
1-chloro-1,2-dimethoxyethene (PubChem CID 57036207) has the molecular formula C4H7ClO2
and a molecular weight of 122.55 g/mol. Its IUPAC name is 1-chloro-1,2-dimethoxyethene.
Molecular Properties
| Compound Name | 1-chloro-1,2-dimethoxyethene |
| PubChem CID | 57036207 |
| Molecular Formula | C4H7ClO2 |
| Molecular Weight | 122.55 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | 1-chloro-1,2-dimethoxyethene |
| SMILES | COC=C(Cl)OC |
| InChI | InChI=1S/C4H7ClO2/c1-6-3-4(5)7-2/h3H,1-2H3 |
| InChIKey | UPSNWSZKVITFLM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,2-dimethoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,2-dimethoxyethene?
The IUPAC name of 1-chloro-1,2-dimethoxyethene (CID 57036207) is 1-chloro-1,2-dimethoxyethene.
What is the SMILES notation for 1-chloro-1,2-dimethoxyethene?
The canonical SMILES for 1-chloro-1,2-dimethoxyethene is COC=C(Cl)OC.
What is the InChIKey of 1-chloro-1,2-dimethoxyethene?
The InChIKey is UPSNWSZKVITFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2/c1-6-3-4(5)7-2/h3H,1-2H3.
What are the key properties of 1-chloro-1,2-dimethoxyethene?
1-chloro-1,2-dimethoxyethene has a molecular weight of 122.55 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,2-dimethoxyethene is sourced from PubChem (CID 57036207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).