About 1,7-dihydropyrano[3,4-b]pyrrole
1,7-dihydropyrano[3,4-b]pyrrole (PubChem CID 57036519) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 1,7-dihydropyrano[3,4-b]pyrrole.
Molecular Properties
| Compound Name | 1,7-dihydropyrano[3,4-b]pyrrole |
| PubChem CID | 57036519 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 1,7-dihydropyrano[3,4-b]pyrrole |
| SMILES | C1=Cc2cc[nH]c2CO1 |
| InChI | InChI=1S/C7H7NO/c1-3-8-7-5-9-4-2-6(1)7/h1-4,8H,5H2 |
| InChIKey | STNJQRCLPBLQSW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,7-dihydropyrano[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydropyrano[3,4-b]pyrrole?
The IUPAC name of 1,7-dihydropyrano[3,4-b]pyrrole (CID 57036519) is 1,7-dihydropyrano[3,4-b]pyrrole.
What is the SMILES notation for 1,7-dihydropyrano[3,4-b]pyrrole?
The canonical SMILES for 1,7-dihydropyrano[3,4-b]pyrrole is C1=Cc2cc[nH]c2CO1.
What is the InChIKey of 1,7-dihydropyrano[3,4-b]pyrrole?
The InChIKey is STNJQRCLPBLQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-3-8-7-5-9-4-2-6(1)7/h1-4,8H,5H2.
What are the key properties of 1,7-dihydropyrano[3,4-b]pyrrole?
1,7-dihydropyrano[3,4-b]pyrrole has a molecular weight of 121.14 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrano[3,4-b]pyrrole is sourced from PubChem (CID 57036519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).