About 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine
1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine (PubChem CID 57036835) has the molecular formula C10H9F6N3
and a molecular weight of 285.19 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine |
| PubChem CID | 57036835 |
| Molecular Formula | C10H9F6N3 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F6N3/c1-19(8(17)18)7-3-5(9(11,12)13)2-6(4-7)10(14,15)16/h2-4H,1H3,(H3,17,18) |
| InChIKey | DXCOAXJTUKWFTI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine (CID 57036835) is 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine is [H]/N=C(\N)N(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine?
The InChIKey is DXCOAXJTUKWFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F6N3/c1-19(8(17)18)7-3-5(9(11,12)13)2-6(4-7)10(14,15)16/h2-4H,1H3,(H3,17,18).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine?
1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine has a molecular weight of 285.19 g/mol, XLogP of 3.05, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-1-methylguanidine is sourced from PubChem (CID 57036835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).