C20H29NO3 — CID 57036876
(4aR,5R,6R,7R)-6-butoxy-7-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one (PubChem CID 57036876) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (4aR,5R,6R,7R)-6-butoxy-7-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one.
| Compound Name | (4aR,5R,6R,7R)-6-butoxy-7-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one |
|---|---|
| PubChem CID | 57036876 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (4aR,5R,6R,7R)-6-butoxy-7-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one |
| SMILES | CCCCO[C@H]1[C@H](O)C=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C20H29NO3/c1-6-7-8-24-18-13(3)20(4)11-15-12(2)19(23)21(5)16(15)9-14(20)10-17(18)22/h9-10,13,17-18,22H,6-8,11H2,1-5H3/t13-,17+,18+,20+/m0/s1 |
| InChIKey | LTOPOZWVRGPJMK-DOFJYSBOSA-N |
| XLogP | 3.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|