C28H36 — CID 57036925
5-deca-1,3,7,9-tetraenyl-6-methylidene-5-nona-1,6,8-trienylcycloocta-1,3-diene (PubChem CID 57036925) has the molecular formula C28H36 and a molecular weight of 372.60 g/mol. Its IUPAC name is 5-deca-1,3,7,9-tetraenyl-6-methylidene-5-nona-1,6,8-trienylcycloocta-1,3-diene.
| Compound Name | 5-deca-1,3,7,9-tetraenyl-6-methylidene-5-nona-1,6,8-trienylcycloocta-1,3-diene |
|---|---|
| PubChem CID | 57036925 |
| Molecular Formula | C28H36 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 5-deca-1,3,7,9-tetraenyl-6-methylidene-5-nona-1,6,8-trienylcycloocta-1,3-diene |
| SMILES | C=CC=CCCC=CC=CC1(C=CCCCC=CC=C)C=CC=CCCC1=C |
| InChI | InChI=1S/C28H36/c1-4-6-8-10-12-14-17-21-25-28(24-20-16-13-11-9-7-5-2)26-22-18-15-19-23-27(28)3/h4-9,14-15,17-18,20-22,24-26H,1-3,10-13,16,19,23H2 |
| InChIKey | GBDSXCDZPRKUHK-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|