C21H25NO7 — CID 57036955
diethyl 2-formyl-4-(2-methoxycarbonylphenyl)-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 57036955) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is diethyl 2-formyl-4-(2-methoxycarbonylphenyl)-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-formyl-4-(2-methoxycarbonylphenyl)-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57036955 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | diethyl 2-formyl-4-(2-methoxycarbonylphenyl)-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(C=O)C(C(=O)OCC)C1c1ccccc1C(=O)OC |
| InChI | InChI=1S/C21H25NO7/c1-5-28-20(25)16-12(3)22-15(11-23)18(21(26)29-6-2)17(16)13-9-7-8-10-14(13)19(24)27-4/h7-11,15-18H,5-6H2,1-4H3 |
| InChIKey | VHCJCSXAZIIVCW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|