C33H37N3O2 — CID 57036967
5-(dimethylamino)-2-[[4-(dimethylamino)phenyl]-[4-[(4-ethylphenyl)methylamino]phenyl]methyl]benzoic acid (PubChem CID 57036967) has the molecular formula C33H37N3O2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[[4-(dimethylamino)phenyl]-[4-[(4-ethylphenyl)methylamino]phenyl]methyl]benzoic acid.
| Compound Name | 5-(dimethylamino)-2-[[4-(dimethylamino)phenyl]-[4-[(4-ethylphenyl)methylamino]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 57036967 |
| Molecular Formula | C33H37N3O2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 5-(dimethylamino)-2-[[4-(dimethylamino)phenyl]-[4-[(4-ethylphenyl)methylamino]phenyl]methyl]benzoic acid |
| SMILES | CCc1ccc(CNc2ccc(C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O2/c1-6-23-7-9-24(10-8-23)22-34-27-15-11-25(12-16-27)32(26-13-17-28(18-14-26)35(2)3)30-20-19-29(36(4)5)21-31(30)33(37)38/h7-21,32,34H,6,22H2,1-5H3,(H,37,38) |
| InChIKey | JHZMDLZWJRANIG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|