C11H16N2O — CID 57037124
6,6-dimethyl-1,4,5,7-tetrahydroindole-3-carboxamide (PubChem CID 57037124) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydroindole-3-carboxamide.
| Compound Name | 6,6-dimethyl-1,4,5,7-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 57037124 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 6,6-dimethyl-1,4,5,7-tetrahydroindole-3-carboxamide |
| SMILES | CC1(C)CCc2c(C(N)=O)c[nH]c2C1 |
| InChI | InChI=1S/C11H16N2O/c1-11(2)4-3-7-8(10(12)14)6-13-9(7)5-11/h6,13H,3-5H2,1-2H3,(H2,12,14) |
| InChIKey | GNSYMQUPVKVFCG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |