About 3-iminooctanoic acid
3-iminooctanoic acid (PubChem CID 57037657) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-iminooctanoic acid.
Molecular Properties
| Compound Name | 3-iminooctanoic acid |
| PubChem CID | 57037657 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-iminooctanoic acid |
| SMILES | [H]/N=C(\CCCCC)CC(=O)O |
| InChI | InChI=1S/C8H15NO2/c1-2-3-4-5-7(9)6-8(10)11/h9H,2-6H2,1H3,(H,10,11)/b9-7+ |
| InChIKey | QDVLLWDQEWCATE-VQHVLOKHSA-N |
| XLogP | 2.06 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminooctanoic acid?
The IUPAC name of 3-iminooctanoic acid (CID 57037657) is 3-iminooctanoic acid.
What is the SMILES notation for 3-iminooctanoic acid?
The canonical SMILES for 3-iminooctanoic acid is [H]/N=C(\CCCCC)CC(=O)O.
What is the InChIKey of 3-iminooctanoic acid?
The InChIKey is QDVLLWDQEWCATE-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-3-4-5-7(9)6-8(10)11/h9H,2-6H2,1H3,(H,10,11)/b9-7+.
What are the key properties of 3-iminooctanoic acid?
3-iminooctanoic acid has a molecular weight of 157.21 g/mol, XLogP of 2.06, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminooctanoic acid is sourced from PubChem (CID 57037657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).