C10H16N2O2 — CID 57037804
4,6-diaminodeca-1,9-diene-3,8-dione (PubChem CID 57037804) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,6-diaminodeca-1,9-diene-3,8-dione.
| Compound Name | 4,6-diaminodeca-1,9-diene-3,8-dione |
|---|---|
| PubChem CID | 57037804 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4,6-diaminodeca-1,9-diene-3,8-dione |
| SMILES | C=CC(=O)CC(N)CC(N)C(=O)C=C |
| InChI | InChI=1S/C10H16N2O2/c1-3-8(13)5-7(11)6-9(12)10(14)4-2/h3-4,7,9H,1-2,5-6,11-12H2 |
| InChIKey | IVHBGVTYZKPMKM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|