C21H26ClFO3 — CID 57037881
(8S,9R,10R,13S,14S,17S)-17-acetyl-9-chloro-2-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione (PubChem CID 57037881) has the molecular formula C21H26ClFO3 and a molecular weight of 380.89 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S,17S)-17-acetyl-9-chloro-2-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione.
| Compound Name | (8S,9R,10R,13S,14S,17S)-17-acetyl-9-chloro-2-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione |
|---|---|
| PubChem CID | 57037881 |
| Molecular Formula | C21H26ClFO3 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (8S,9R,10R,13S,14S,17S)-17-acetyl-9-chloro-2-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(F)C(=O)[C@]4(C)[C@@]3(Cl)CC[C@]12C |
| InChI | InChI=1S/C21H26ClFO3/c1-11(24)13-6-7-14-15-5-4-12-10-16(25)17(23)18(26)20(12,3)21(15,22)9-8-19(13,14)2/h10,13-15,17H,4-9H2,1-3H3/t13-,14+,15+,17?,19-,20-,21-/m1/s1 |
| InChIKey | HCWYKGUMDSFVON-PVJKRBEISA-N |
| XLogP | 4.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|