C13H22N2O2 — CID 57037958
4-amino-5-(3-aminopropyl)-2,7-dimethylocta-1,7-diene-3,6-dione (PubChem CID 57037958) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-amino-5-(3-aminopropyl)-2,7-dimethylocta-1,7-diene-3,6-dione.
| Compound Name | 4-amino-5-(3-aminopropyl)-2,7-dimethylocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 57037958 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4-amino-5-(3-aminopropyl)-2,7-dimethylocta-1,7-diene-3,6-dione |
| SMILES | C=C(C)C(=O)C(N)C(CCCN)C(=O)C(=C)C |
| InChI | InChI=1S/C13H22N2O2/c1-8(2)12(16)10(6-5-7-14)11(15)13(17)9(3)4/h10-11H,1,3,5-7,14-15H2,2,4H3 |
| InChIKey | JENREPBWVGFGLD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|