About (dibenzylamino) 2,2,2-trifluoroacetate
(dibenzylamino) 2,2,2-trifluoroacetate (PubChem CID 57038563) has the molecular formula C16H14F3NO2
and a molecular weight of 309.29 g/mol. Its IUPAC name is (dibenzylamino) 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (dibenzylamino) 2,2,2-trifluoroacetate |
| PubChem CID | 57038563 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (dibenzylamino) 2,2,2-trifluoroacetate |
| SMILES | O=C(ON(Cc1ccccc1)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO2/c17-16(18,19)15(21)22-20(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | QPIIVIJTEONYQR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (dibenzylamino) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dibenzylamino) 2,2,2-trifluoroacetate?
The IUPAC name of (dibenzylamino) 2,2,2-trifluoroacetate (CID 57038563) is (dibenzylamino) 2,2,2-trifluoroacetate.
What is the SMILES notation for (dibenzylamino) 2,2,2-trifluoroacetate?
The canonical SMILES for (dibenzylamino) 2,2,2-trifluoroacetate is O=C(ON(Cc1ccccc1)Cc1ccccc1)C(F)(F)F.
What is the InChIKey of (dibenzylamino) 2,2,2-trifluoroacetate?
The InChIKey is QPIIVIJTEONYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO2/c17-16(18,19)15(21)22-20(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2.
What are the key properties of (dibenzylamino) 2,2,2-trifluoroacetate?
(dibenzylamino) 2,2,2-trifluoroacetate has a molecular weight of 309.29 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (dibenzylamino) 2,2,2-trifluoroacetate is sourced from PubChem (CID 57038563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).