About N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine
N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine (PubChem CID 57038611) has the molecular formula C4H6N4O4
and a molecular weight of 174.12 g/mol. Its IUPAC name is N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine |
| PubChem CID | 57038611 |
| Molecular Formula | C4H6N4O4 |
| Molecular Weight | 174.12 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine |
| SMILES | O=NCC(=NO)C(CN=O)N=O |
| InChI | InChI=1S/C4H6N4O4/c9-5-1-3(7-11)4(8-12)2-6-10/h3,12H,1-2H2 |
| InChIKey | CNEMHIAXLAFLGX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine?
The IUPAC name of N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine (CID 57038611) is N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine.
What is the SMILES notation for N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine?
The canonical SMILES for N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine is O=NCC(=NO)C(CN=O)N=O.
What is the InChIKey of N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine?
The InChIKey is CNEMHIAXLAFLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O4/c9-5-1-3(7-11)4(8-12)2-6-10/h3,12H,1-2H2.
What are the key properties of N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine?
N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine has a molecular weight of 174.12 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3,4-trinitrosobutan-2-ylidene)hydroxylamine is sourced from PubChem (CID 57038611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).