C34H27F6NO2 — CID 57038754
N-[2,2-bis[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-N-phenylnaphthalen-2-amine (PubChem CID 57038754) has the molecular formula C34H27F6NO2 and a molecular weight of 595.58 g/mol. Its IUPAC name is N-[2,2-bis[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-N-phenylnaphthalen-2-amine.
| Compound Name | N-[2,2-bis[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-N-phenylnaphthalen-2-amine |
|---|---|
| PubChem CID | 57038754 |
| Molecular Formula | C34H27F6NO2 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | N-[2,2-bis[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-N-phenylnaphthalen-2-amine |
| SMILES | FC(F)(F)COc1ccc(C(CN(c2ccccc2)c2ccc3ccccc3c2)c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H27F6NO2/c35-33(36,37)22-42-30-16-11-25(12-17-30)32(26-13-18-31(19-14-26)43-23-34(38,39)40)21-41(28-8-2-1-3-9-28)29-15-10-24-6-4-5-7-27(24)20-29/h1-20,32H,21-23H2 |
| InChIKey | VPPVDRIHJLMJAC-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |