About 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one
9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 57038765) has the molecular formula C8H10N4O
and a molecular weight of 178.20 g/mol. Its IUPAC name is 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 57038765 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | NN=C1CCCn2c1nccc2=O |
| InChI | InChI=1S/C8H10N4O/c9-11-6-2-1-5-12-7(13)3-4-10-8(6)12/h3-4H,1-2,5,9H2 |
| InChIKey | ZZJXLVGUQYSGJB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (CID 57038765) is 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one is NN=C1CCCn2c1nccc2=O.
What is the InChIKey of 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is ZZJXLVGUQYSGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-11-6-2-1-5-12-7(13)3-4-10-8(6)12/h3-4H,1-2,5,9H2.
What are the key properties of 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 178.20 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydrazinylidene-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 57038765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).