About 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium
1-methyl-7H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 57039142) has the molecular formula C7H8N3+
and a molecular weight of 134.16 g/mol. Its IUPAC name is 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium.
Molecular Properties
| Compound Name | 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium |
| PubChem CID | 57039142 |
| Molecular Formula | C7H8N3+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Cn1cnc2c1CC=[N+]=C2 |
| InChI | InChI=1S/C7H8N3/c1-10-5-9-6-4-8-3-2-7(6)10/h3-5H,2H2,1H3/q+1 |
| InChIKey | HWYIMCIYRUWDDF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 31.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium?
The IUPAC name of 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium (CID 57039142) is 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium.
What is the SMILES notation for 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium?
The canonical SMILES for 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium is Cn1cnc2c1CC=[N+]=C2.
What is the InChIKey of 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium?
The InChIKey is HWYIMCIYRUWDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3/c1-10-5-9-6-4-8-3-2-7(6)10/h3-5H,2H2,1H3/q+1.
What are the key properties of 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium?
1-methyl-7H-imidazo[4,5-c]pyridin-5-ium has a molecular weight of 134.16 g/mol, XLogP of -0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7H-imidazo[4,5-c]pyridin-5-ium is sourced from PubChem (CID 57039142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).