C7H13N2+ — CID 57039496
(4R,8S)-2,3,7,8-tetrahydro-1H-pyrrolizin-4-ium-4-amine (PubChem CID 57039496) has the molecular formula C7H13N2+ and a molecular weight of 125.19 g/mol. Its IUPAC name is (4R,8S)-2,3,7,8-tetrahydro-1H-pyrrolizin-4-ium-4-amine.
| Compound Name | (4R,8S)-2,3,7,8-tetrahydro-1H-pyrrolizin-4-ium-4-amine |
|---|---|
| PubChem CID | 57039496 |
| Molecular Formula | C7H13N2+ |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | (4R,8S)-2,3,7,8-tetrahydro-1H-pyrrolizin-4-ium-4-amine |
| SMILES | N[N@@+]12C=CC[C@@H]1CCC2 |
| InChI | InChI=1S/C7H13N2/c8-9-5-1-3-7(9)4-2-6-9/h1,5,7H,2-4,6,8H2/q+1/t7-,9-/m1/s1 |
| InChIKey | OYEPWJCDLWYYEP-VXNVDRBHSA-N |
| XLogP | 0.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|