C23H42O4 — CID 57039627
1-[7-ethyl-2-hydroxy-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 57039627) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is 1-[7-ethyl-2-hydroxy-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | 1-[7-ethyl-2-hydroxy-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 57039627 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 1-[7-ethyl-2-hydroxy-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CCC(CC)(CCC=CC(C)(O)C1CCC2C(O)CCCC21C)OCOC |
| InChI | InChI=1S/C23H42O4/c1-6-23(7-2,27-17-26-5)16-9-8-15-22(4,25)20-13-12-18-19(24)11-10-14-21(18,20)3/h8,15,18-20,24-25H,6-7,9-14,16-17H2,1-5H3 |
| InChIKey | MJJPUGCWTYRMTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|