C6H8O7S — CID 57039649
(3R,4S,5R)-5-[(2R)-2,3-dihydroxy-1-oxothiiran-2-yl]-3,4-dihydroxyoxolan-2-one (PubChem CID 57039649) has the molecular formula C6H8O7S and a molecular weight of 224.19 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(2R)-2,3-dihydroxy-1-oxothiiran-2-yl]-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3R,4S,5R)-5-[(2R)-2,3-dihydroxy-1-oxothiiran-2-yl]-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 57039649 |
| Molecular Formula | C6H8O7S |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (3R,4S,5R)-5-[(2R)-2,3-dihydroxy-1-oxothiiran-2-yl]-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1O[C@@H]([C@]2(O)C(O)S2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H8O7S/c7-1-2(8)4(9)13-3(1)6(11)5(10)14(6)12/h1-3,5,7-8,10-11H/t1-,2+,3+,5?,6+,14?/m0/s1 |
| InChIKey | NSUDDKAHBNNZRU-LIURXFHYSA-N |
| XLogP | -3.60 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|