C16H17NO7S — CID 57040305
6-(1-hydroxyethyl)-3-(4-methylphenyl)sulfonyloxy-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 57040305) has the molecular formula C16H17NO7S and a molecular weight of 367.38 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-3-(4-methylphenyl)sulfonyloxy-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 6-(1-hydroxyethyl)-3-(4-methylphenyl)sulfonyloxy-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57040305 |
| Molecular Formula | C16H17NO7S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 6-(1-hydroxyethyl)-3-(4-methylphenyl)sulfonyloxy-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC2=C(C(=O)O)N3C(=O)C(C(C)O)C3C2)cc1 |
| InChI | InChI=1S/C16H17NO7S/c1-8-3-5-10(6-4-8)25(22,23)24-12-7-11-13(9(2)18)15(19)17(11)14(12)16(20)21/h3-6,9,11,13,18H,7H2,1-2H3,(H,20,21) |
| InChIKey | HDYRYWVJJMLCKR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|