C16H15BrFN — CID 57040405
4-(3-bromo-4-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine (PubChem CID 57040405) has the molecular formula C16H15BrFN and a molecular weight of 320.20 g/mol. Its IUPAC name is 4-(3-bromo-4-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine.
| Compound Name | 4-(3-bromo-4-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
|---|---|
| PubChem CID | 57040405 |
| Molecular Formula | C16H15BrFN |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-(3-bromo-4-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
| SMILES | [H]/N=C1\C=C2C=CCCC2C(c2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C16H15BrFN/c17-15-8-11(5-6-16(15)18)14-9-12(19)7-10-3-1-2-4-13(10)14/h1,3,5-8,13-14,19H,2,4,9H2/b19-12+ |
| InChIKey | VNRPTGAAJWTDLB-XDHOZWIPSA-N |
| XLogP | 4.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|