C22H27BrN2O — CID 57040521
3-[(R)-(4-bromophenyl)-[(2R,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenol (PubChem CID 57040521) has the molecular formula C22H27BrN2O and a molecular weight of 415.38 g/mol. Its IUPAC name is 3-[(R)-(4-bromophenyl)-[(2R,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenol.
| Compound Name | 3-[(R)-(4-bromophenyl)-[(2R,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 57040521 |
| Molecular Formula | C22H27BrN2O |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-[(R)-(4-bromophenyl)-[(2R,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenol |
| SMILES | C=CCN1C[C@@H](C)N(C(c2ccc(Br)cc2)c2cccc(O)c2)C[C@@H]1C |
| InChI | InChI=1S/C22H27BrN2O/c1-4-12-24-14-17(3)25(15-16(24)2)22(18-8-10-20(23)11-9-18)19-6-5-7-21(26)13-19/h4-11,13,16-17,22,26H,1,12,14-15H2,2-3H3/t16-,17+,22?/m0/s1 |
| InChIKey | SWPGVIMLCKSGMJ-NCHORFDRSA-N |
| XLogP | 4.82 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|