About 5,6-dihydro-1H-furo[2,3-d]imidazole
5,6-dihydro-1H-furo[2,3-d]imidazole (PubChem CID 57040555) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is 5,6-dihydro-1H-furo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-furo[2,3-d]imidazole |
| PubChem CID | 57040555 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 5,6-dihydro-1H-furo[2,3-d]imidazole |
| SMILES | c1nc2c([nH]1)CCO2 |
| InChI | InChI=1S/C5H6N2O/c1-2-8-5-4(1)6-3-7-5/h3H,1-2H2,(H,6,7) |
| InChIKey | LYNPJBQORVCWPE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1H-furo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-furo[2,3-d]imidazole?
The IUPAC name of 5,6-dihydro-1H-furo[2,3-d]imidazole (CID 57040555) is 5,6-dihydro-1H-furo[2,3-d]imidazole.
What is the SMILES notation for 5,6-dihydro-1H-furo[2,3-d]imidazole?
The canonical SMILES for 5,6-dihydro-1H-furo[2,3-d]imidazole is c1nc2c([nH]1)CCO2.
What is the InChIKey of 5,6-dihydro-1H-furo[2,3-d]imidazole?
The InChIKey is LYNPJBQORVCWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O/c1-2-8-5-4(1)6-3-7-5/h3H,1-2H2,(H,6,7).
What are the key properties of 5,6-dihydro-1H-furo[2,3-d]imidazole?
5,6-dihydro-1H-furo[2,3-d]imidazole has a molecular weight of 110.12 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-furo[2,3-d]imidazole is sourced from PubChem (CID 57040555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).