About N,N-diethyloxolan-3-amine
N,N-diethyloxolan-3-amine (PubChem CID 57040633) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N,N-diethyloxolan-3-amine.
Molecular Properties
| Compound Name | N,N-diethyloxolan-3-amine |
| PubChem CID | 57040633 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N,N-diethyloxolan-3-amine |
| SMILES | CCN(CC)C1CCOC1 |
| InChI | InChI=1S/C8H17NO/c1-3-9(4-2)8-5-6-10-7-8/h8H,3-7H2,1-2H3 |
| InChIKey | NGWYNBQNZYMOII-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyloxolan-3-amine?
The IUPAC name of N,N-diethyloxolan-3-amine (CID 57040633) is N,N-diethyloxolan-3-amine.
What is the SMILES notation for N,N-diethyloxolan-3-amine?
The canonical SMILES for N,N-diethyloxolan-3-amine is CCN(CC)C1CCOC1.
What is the InChIKey of N,N-diethyloxolan-3-amine?
The InChIKey is NGWYNBQNZYMOII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-9(4-2)8-5-6-10-7-8/h8H,3-7H2,1-2H3.
What are the key properties of N,N-diethyloxolan-3-amine?
N,N-diethyloxolan-3-amine has a molecular weight of 143.23 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyloxolan-3-amine is sourced from PubChem (CID 57040633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).