About diacetyloxy(oxo)azanium
diacetyloxy(oxo)azanium (PubChem CID 57040694) has the molecular formula C4H6NO5+
and a molecular weight of 148.09 g/mol. Its IUPAC name is diacetyloxy(oxo)azanium.
Molecular Properties
| Compound Name | diacetyloxy(oxo)azanium |
| PubChem CID | 57040694 |
| Molecular Formula | C4H6NO5+ |
| Molecular Weight | 148.09 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | diacetyloxy(oxo)azanium |
| SMILES | CC(=O)O[N+](=O)OC(C)=O |
| InChI | InChI=1S/C4H6NO5/c1-3(6)9-5(8)10-4(2)7/h1-2H3/q+1 |
| InChIKey | CQECINKVQDYCAY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.09 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diacetyloxy(oxo)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetyloxy(oxo)azanium?
The IUPAC name of diacetyloxy(oxo)azanium (CID 57040694) is diacetyloxy(oxo)azanium.
What is the SMILES notation for diacetyloxy(oxo)azanium?
The canonical SMILES for diacetyloxy(oxo)azanium is CC(=O)O[N+](=O)OC(C)=O.
What is the InChIKey of diacetyloxy(oxo)azanium?
The InChIKey is CQECINKVQDYCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6NO5/c1-3(6)9-5(8)10-4(2)7/h1-2H3/q+1.
What are the key properties of diacetyloxy(oxo)azanium?
diacetyloxy(oxo)azanium has a molecular weight of 148.09 g/mol, XLogP of -0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diacetyloxy(oxo)azanium is sourced from PubChem (CID 57040694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).