About 1-ethoxyethenylbenzene
1-ethoxyethenylbenzene (PubChem CID 570407) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 1-ethoxyethenylbenzene.
Molecular Properties
| Compound Name | 1-ethoxyethenylbenzene |
| PubChem CID | 570407 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-ethoxyethenylbenzene |
| SMILES | C=C(OCC)c1ccccc1 |
| InChI | InChI=1S/C10H12O/c1-3-11-9(2)10-7-5-4-6-8-10/h4-8H,2-3H2,1H3 |
| InChIKey | PDNJMHZLMGTCDU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethenylbenzene?
The IUPAC name of 1-ethoxyethenylbenzene (CID 570407) is 1-ethoxyethenylbenzene.
What is the SMILES notation for 1-ethoxyethenylbenzene?
The canonical SMILES for 1-ethoxyethenylbenzene is C=C(OCC)c1ccccc1.
What is the InChIKey of 1-ethoxyethenylbenzene?
The InChIKey is PDNJMHZLMGTCDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-3-11-9(2)10-7-5-4-6-8-10/h4-8H,2-3H2,1H3.
What are the key properties of 1-ethoxyethenylbenzene?
1-ethoxyethenylbenzene has a molecular weight of 148.20 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethenylbenzene is sourced from PubChem (CID 570407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).