About 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one
6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one (PubChem CID 57040979) has the molecular formula C18H25Cl2NO4
and a molecular weight of 390.31 g/mol. Its IUPAC name is 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one.
Molecular Properties
| Compound Name | 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one |
| PubChem CID | 57040979 |
| Molecular Formula | C18H25Cl2NO4 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one |
| SMILES | COCC(=O)C(CC(CN)c1ccc(Cl)c(Cl)c1)OC1CCCCO1 |
| InChI | InChI=1S/C18H25Cl2NO4/c1-23-11-16(22)17(25-18-4-2-3-7-24-18)9-13(10-21)12-5-6-14(19)15(20)8-12/h5-6,8,13,17-18H,2-4,7,9-11,21H2,1H3 |
| InChIKey | HGBIYGKXCNWTSO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one?
The IUPAC name of 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one (CID 57040979) is 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one.
What is the SMILES notation for 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one?
The canonical SMILES for 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one is COCC(=O)C(CC(CN)c1ccc(Cl)c(Cl)c1)OC1CCCCO1.
What is the InChIKey of 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one?
The InChIKey is HGBIYGKXCNWTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Cl2NO4/c1-23-11-16(22)17(25-18-4-2-3-7-24-18)9-13(10-21)12-5-6-14(19)15(20)8-12/h5-6,8,13,17-18H,2-4,7,9-11,21H2,1H3.
What are the key properties of 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one?
6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one has a molecular weight of 390.31 g/mol, XLogP of 3.55, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(3,4-dichlorophenyl)-1-methoxy-3-(oxan-2-yloxy)hexan-2-one is sourced from PubChem (CID 57040979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).