C17H21NO4S — CID 57041308
2-(4-methylphenyl)sulfonyl-2-(1H-pyrrol-2-yl)hexanoic acid (PubChem CID 57041308) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-2-(1H-pyrrol-2-yl)hexanoic acid.
| Compound Name | 2-(4-methylphenyl)sulfonyl-2-(1H-pyrrol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 57041308 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-2-(1H-pyrrol-2-yl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)(c1ccc[nH]1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO4S/c1-3-4-11-17(16(19)20,15-6-5-12-18-15)23(21,22)14-9-7-13(2)8-10-14/h5-10,12,18H,3-4,11H2,1-2H3,(H,19,20) |
| InChIKey | IRDPOUOTKXVULD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |