C24H26O2 — CID 57041430
2-[2,2-bis(4-methoxyphenyl)ethyl]-1,3-dimethylbenzene (PubChem CID 57041430) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[2,2-bis(4-methoxyphenyl)ethyl]-1,3-dimethylbenzene.
| Compound Name | 2-[2,2-bis(4-methoxyphenyl)ethyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 57041430 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[2,2-bis(4-methoxyphenyl)ethyl]-1,3-dimethylbenzene |
| SMILES | COc1ccc(C(Cc2c(C)cccc2C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H26O2/c1-17-6-5-7-18(2)23(17)16-24(19-8-12-21(25-3)13-9-19)20-10-14-22(26-4)15-11-20/h5-15,24H,16H2,1-4H3 |
| InChIKey | OHSLNULRYRWDLI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |