C34H43N5O6 — CID 57041540
N-[4-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-1-hydroxy-2-(4-methoxyphenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide (PubChem CID 57041540) has the molecular formula C34H43N5O6 and a molecular weight of 617.75 g/mol. Its IUPAC name is N-[4-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-1-hydroxy-2-(4-methoxyphenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide.
| Compound Name | N-[4-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-1-hydroxy-2-(4-methoxyphenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 57041540 |
| Molecular Formula | C34H43N5O6 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | N-[4-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-1-hydroxy-2-(4-methoxyphenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide |
| SMILES | COc1ccc(C(CCN2CCCN(c3nc4ccccc4[nH]3)CC2)C(O)NC(=O)c2cc(OC)c(OC)c(OC)c2C)cc1 |
| InChI | InChI=1S/C34H43N5O6/c1-22-26(21-29(43-3)31(45-5)30(22)44-4)33(41)37-32(40)25(23-11-13-24(42-2)14-12-23)15-18-38-16-8-17-39(20-19-38)34-35-27-9-6-7-10-28(27)36-34/h6-7,9-14,21,25,32,40H,8,15-20H2,1-5H3,(H,35,36)(H,37,41) |
| InChIKey | AHPWQNGFMQAPJW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|