About 3-ethylhexanenitrile
3-ethylhexanenitrile (PubChem CID 57041582) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 3-ethylhexanenitrile.
Molecular Properties
| Compound Name | 3-ethylhexanenitrile |
| PubChem CID | 57041582 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 3-ethylhexanenitrile |
| SMILES | CCCC(CC)CC#N |
| InChI | InChI=1S/C8H15N/c1-3-5-8(4-2)6-7-9/h8H,3-6H2,1-2H3 |
| InChIKey | OQIGRYGTYBHVFI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexanenitrile?
The IUPAC name of 3-ethylhexanenitrile (CID 57041582) is 3-ethylhexanenitrile.
What is the SMILES notation for 3-ethylhexanenitrile?
The canonical SMILES for 3-ethylhexanenitrile is CCCC(CC)CC#N.
What is the InChIKey of 3-ethylhexanenitrile?
The InChIKey is OQIGRYGTYBHVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-3-5-8(4-2)6-7-9/h8H,3-6H2,1-2H3.
What are the key properties of 3-ethylhexanenitrile?
3-ethylhexanenitrile has a molecular weight of 125.21 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexanenitrile is sourced from PubChem (CID 57041582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).