About 2-sulfanyl-1,3-dihydrobenzotriazole
2-sulfanyl-1,3-dihydrobenzotriazole (PubChem CID 57041779) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is 2-sulfanyl-1,3-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 2-sulfanyl-1,3-dihydrobenzotriazole |
| PubChem CID | 57041779 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2-sulfanyl-1,3-dihydrobenzotriazole |
| SMILES | SN1Nc2ccccc2N1 |
| InChI | InChI=1S/C6H7N3S/c10-9-7-5-3-1-2-4-6(5)8-9/h1-4,7-8,10H |
| InChIKey | WPWTWTUCFXTJGC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-1,3-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-1,3-dihydrobenzotriazole?
The IUPAC name of 2-sulfanyl-1,3-dihydrobenzotriazole (CID 57041779) is 2-sulfanyl-1,3-dihydrobenzotriazole.
What is the SMILES notation for 2-sulfanyl-1,3-dihydrobenzotriazole?
The canonical SMILES for 2-sulfanyl-1,3-dihydrobenzotriazole is SN1Nc2ccccc2N1.
What is the InChIKey of 2-sulfanyl-1,3-dihydrobenzotriazole?
The InChIKey is WPWTWTUCFXTJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c10-9-7-5-3-1-2-4-6(5)8-9/h1-4,7-8,10H.
What are the key properties of 2-sulfanyl-1,3-dihydrobenzotriazole?
2-sulfanyl-1,3-dihydrobenzotriazole has a molecular weight of 153.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-1,3-dihydrobenzotriazole is sourced from PubChem (CID 57041779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).