About 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid
7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid (PubChem CID 57041907) has the molecular formula C16H15ClO4
and a molecular weight of 306.75 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid.
Molecular Properties
| Compound Name | 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid |
| PubChem CID | 57041907 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid |
| SMILES | CCOC(=O)C(C=CC(=O)O)=CC=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClO4/c1-2-21-16(20)13(8-11-15(18)19)5-3-4-12-6-9-14(17)10-7-12/h3-11H,2H2,1H3,(H,18,19) |
| InChIKey | GSXQXOMMZVWRTR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid?
The IUPAC name of 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid (CID 57041907) is 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid.
What is the SMILES notation for 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid?
The canonical SMILES for 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid is CCOC(=O)C(C=CC(=O)O)=CC=Cc1ccc(Cl)cc1.
What is the InChIKey of 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid?
The InChIKey is GSXQXOMMZVWRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO4/c1-2-21-16(20)13(8-11-15(18)19)5-3-4-12-6-9-14(17)10-7-12/h3-11H,2H2,1H3,(H,18,19).
What are the key properties of 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid?
7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid has a molecular weight of 306.75 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-chlorophenyl)-4-ethoxycarbonylhepta-2,4,6-trienoic acid is sourced from PubChem (CID 57041907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).