About 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide
9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide (PubChem CID 57042394) has the molecular formula C10H14N6O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide.
Molecular Properties
| Compound Name | 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide |
| PubChem CID | 57042394 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide |
| SMILES | CC1CCC(=NN)c2ncc(C(=O)NN)c(=O)n21 |
| InChI | InChI=1S/C10H14N6O2/c1-5-2-3-7(14-11)8-13-4-6(9(17)15-12)10(18)16(5)8/h4-5H,2-3,11-12H2,1H3,(H,15,17) |
| InChIKey | HFZOXRSJNPNPIL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide?
The IUPAC name of 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide (CID 57042394) is 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide.
What is the SMILES notation for 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide?
The canonical SMILES for 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide is CC1CCC(=NN)c2ncc(C(=O)NN)c(=O)n21.
What is the InChIKey of 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide?
The InChIKey is HFZOXRSJNPNPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O2/c1-5-2-3-7(14-11)8-13-4-6(9(17)15-12)10(18)16(5)8/h4-5H,2-3,11-12H2,1H3,(H,15,17).
What are the key properties of 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide?
9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide has a molecular weight of 250.26 g/mol, XLogP of -1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbohydrazide is sourced from PubChem (CID 57042394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).