C22H36F2O4 — CID 57043391
5-[(2S,3aR,4S,5R,6aS)-4-(4,4-difluorooct-1-enyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid (PubChem CID 57043391) has the molecular formula C22H36F2O4 and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-[(2S,3aR,4S,5R,6aS)-4-(4,4-difluorooct-1-enyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid.
| Compound Name | 5-[(2S,3aR,4S,5R,6aS)-4-(4,4-difluorooct-1-enyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid |
|---|---|
| PubChem CID | 57043391 |
| Molecular Formula | C22H36F2O4 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 5-[(2S,3aR,4S,5R,6aS)-4-(4,4-difluorooct-1-enyl)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid |
| SMILES | CCCCC(F)(F)CC=C[C@H]1[C@H]2C[C@H](CCC(C)CC(=O)OO)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C22H36F2O4/c1-4-5-10-22(23,24)11-6-7-18-16(3)13-20-19(18)14-17(27-20)9-8-15(2)12-21(25)28-26/h6-7,15-20,26H,4-5,8-14H2,1-3H3/t15?,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | ZGWLGHGYPVZTOP-CKBJSLFLSA-N |
| XLogP | 6.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|