C29H44O4S — CID 57043727
6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 57043727) has the molecular formula C29H44O4S and a molecular weight of 488.73 g/mol. Its IUPAC name is 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 57043727 |
| Molecular Formula | C29H44O4S |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC[C@@H](C)C[C@H](O)C=C[C@@H]1C(SCCCCCC(=O)O)=C(CCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C29H44O4S/c1-3-4-11-22(2)20-25(30)17-18-26-27(31)21-24(16-15-23-12-7-5-8-13-23)29(26)34-19-10-6-9-14-28(32)33/h5,7-8,12-13,17-18,22,25-27,30-31H,3-4,6,9-11,14-16,19-21H2,1-2H3,(H,32,33)/t22-,25-,26+,27-/m1/s1 |
| InChIKey | NNJKVOMGUOGOBM-DRZCSJLFSA-N |
| XLogP | 6.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|