About 1-(2,3-dihydroxypropyl)-3-methylurea
1-(2,3-dihydroxypropyl)-3-methylurea (PubChem CID 57044153) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)-3-methylurea |
| PubChem CID | 57044153 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-methylurea |
| SMILES | CNC(=O)NCC(O)CO |
| InChI | InChI=1S/C5H12N2O3/c1-6-5(10)7-2-4(9)3-8/h4,8-9H,2-3H2,1H3,(H2,6,7,10) |
| InChIKey | RYMKBEJGCAGRJD-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dihydroxypropyl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)-3-methylurea?
The IUPAC name of 1-(2,3-dihydroxypropyl)-3-methylurea (CID 57044153) is 1-(2,3-dihydroxypropyl)-3-methylurea.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)-3-methylurea?
The canonical SMILES for 1-(2,3-dihydroxypropyl)-3-methylurea is CNC(=O)NCC(O)CO.
What is the InChIKey of 1-(2,3-dihydroxypropyl)-3-methylurea?
The InChIKey is RYMKBEJGCAGRJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O3/c1-6-5(10)7-2-4(9)3-8/h4,8-9H,2-3H2,1H3,(H2,6,7,10).
What are the key properties of 1-(2,3-dihydroxypropyl)-3-methylurea?
1-(2,3-dihydroxypropyl)-3-methylurea has a molecular weight of 148.16 g/mol, XLogP of -1.73, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)-3-methylurea is sourced from PubChem (CID 57044153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).