C32H66O6Si3 — CID 57044160
2-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]acetaldehyde (PubChem CID 57044160) has the molecular formula C32H66O6Si3 and a molecular weight of 631.13 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 57044160 |
| Molecular Formula | C32H66O6Si3 |
| Molecular Weight | 631.13 g/mol |
| Exact Mass | 630.42 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](C[C@@H]2O[C@H]2[C@H](C)[C@H](C)O[Si](CC)(CC)CC)CO[C@@H](CC=O)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H66O6Si3/c1-12-39(13-2,14-3)36-26(11)25(10)30-29(35-30)23-27-24-34-28(21-22-33)32(38-41(18-7,19-8)20-9)31(27)37-40(15-4,16-5)17-6/h22,25-32H,12-21,23-24H2,1-11H3/t25-,26+,27+,28+,29+,30+,31-,32-/m1/s1 |
| InChIKey | MENCFJAVQJOEBU-RAYNAZSSSA-N |
| XLogP | 8.58 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.13 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|