About N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide
N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide (PubChem CID 57044172) has the molecular formula C14H28FNO
and a molecular weight of 245.38 g/mol. Its IUPAC name is N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide.
Molecular Properties
| Compound Name | N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide |
| PubChem CID | 57044172 |
| Molecular Formula | C14H28FNO |
| Molecular Weight | 245.38 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide |
| SMILES | CCCCCC(=O)NC(C)C(C)(F)C(C)CC |
| InChI | InChI=1S/C14H28FNO/c1-6-8-9-10-13(17)16-12(4)14(5,15)11(3)7-2/h11-12H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | AIZZLGSJKYAIIV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide?
The IUPAC name of N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide (CID 57044172) is N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide.
What is the SMILES notation for N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide?
The canonical SMILES for N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide is CCCCCC(=O)NC(C)C(C)(F)C(C)CC.
What is the InChIKey of N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide?
The InChIKey is AIZZLGSJKYAIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28FNO/c1-6-8-9-10-13(17)16-12(4)14(5,15)11(3)7-2/h11-12H,6-10H2,1-5H3,(H,16,17).
What are the key properties of N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide?
N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide has a molecular weight of 245.38 g/mol, XLogP of 3.85, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-3,4-dimethylhexan-2-yl)hexanamide is sourced from PubChem (CID 57044172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).