C23H28N2O4S2 — CID 57044457
methyl 5-[4-[4-(dimethylamino)phenyl]-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate (PubChem CID 57044457) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is methyl 5-[4-[4-(dimethylamino)phenyl]-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[4-[4-(dimethylamino)phenyl]-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57044457 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | methyl 5-[4-[4-(dimethylamino)phenyl]-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC(Cc2ccc(N(C)C)cc2)(c2ccc[nH]2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C23H28N2O4S2/c1-25(2)18-9-7-17(8-10-18)16-23(31(4,27)28,21-6-5-15-24-21)14-13-19-11-12-20(30-19)22(26)29-3/h5-12,15,24H,13-14,16H2,1-4H3 |
| InChIKey | LYMJGTISXXMQNX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|